C28H45N3O3S — CID 166921154
4-[7-[8-[di(propan-2-yl)amino]octylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 166921154) has the molecular formula C28H45N3O3S and a molecular weight of 503.75 g/mol. Its IUPAC name is 4-[7-[8-[di(propan-2-yl)amino]octylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[7-[8-[di(propan-2-yl)amino]octylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166921154 |
| Molecular Formula | C28H45N3O3S |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | 4-[7-[8-[di(propan-2-yl)amino]octylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N1Cc2c(SCCCCCCCCN(C(C)C)C(C)C)cccc2C1=O |
| InChI | InChI=1S/C28H45N3O3S/c1-21(2)30(22(3)4)17-10-8-6-7-9-11-18-35-26-14-12-13-24-25(26)19-31(28(24)34)23(20-32)15-16-27(33)29-5/h12-14,20-23H,6-11,15-19H2,1-5H3,(H,29,33) |
| InChIKey | PREHABRLGPQTDJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|