C29H36Cl2FN3O2S — CID 167062814
3-[4-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 167062814) has the molecular formula C29H36Cl2FN3O2S and a molecular weight of 580.60 g/mol. Its IUPAC name is 3-[4-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167062814 |
| Molecular Formula | C29H36Cl2FN3O2S |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 3-[4-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(NCCCCCCCCSc1cccc2c1CN(C1CCC(=O)NC1=O)C2)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C29H36Cl2FN3O2S/c1-19(27-22(30)11-12-23(32)28(27)31)33-15-6-4-2-3-5-7-16-38-25-10-8-9-20-17-35(18-21(20)25)24-13-14-26(36)34-29(24)37/h8-12,19,24,33H,2-7,13-18H2,1H3,(H,34,36,37) |
| InChIKey | UEGHBXJRSIFBHO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|