C26H30FN3O2S — CID 167062990
3-[4-[[2-fluoro-4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 167062990) has the molecular formula C26H30FN3O2S and a molecular weight of 467.61 g/mol. Its IUPAC name is 3-[4-[[2-fluoro-4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[2-fluoro-4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167062990 |
| Molecular Formula | C26H30FN3O2S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 3-[4-[[2-fluoro-4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(SCc4ccc(CN5CCCCC5)cc4F)c3C2)C(=O)N1 |
| InChI | InChI=1S/C26H30FN3O2S/c27-22-13-18(14-29-11-2-1-3-12-29)7-8-20(22)17-33-24-6-4-5-19-15-30(16-21(19)24)23-9-10-25(31)28-26(23)32/h4-8,13,23H,1-3,9-12,14-17H2,(H,28,31,32) |
| InChIKey | VBTKWXBOYQWNCC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|