C26H28FN3O3S — CID 171064809
3-[6-fluoro-3-oxo-7-[[4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171064809) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is 3-[6-fluoro-3-oxo-7-[[4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-fluoro-3-oxo-7-[[4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171064809 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[6-fluoro-3-oxo-7-[[4-(piperidin-1-ylmethyl)phenyl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(F)c3SCc3ccc(CN4CCCCC4)cc3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28FN3O3S/c27-21-9-8-19-20(15-30(26(19)33)22-10-11-23(31)28-25(22)32)24(21)34-16-18-6-4-17(5-7-18)14-29-12-2-1-3-13-29/h4-9,22H,1-3,10-16H2,(H,28,31,32) |
| InChIKey | LSFCNTDGLNLYHX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|