C23H26N4O3S2 — CID 154689912
3-[3-oxo-7-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689912) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 3-[3-oxo-7-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689912 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-[3-oxo-7-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4nc(CN5CCCCC5)cs4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O3S2/c28-20-8-7-18(22(29)25-20)27-12-17-16(23(27)30)5-4-6-19(17)31-14-21-24-15(13-32-21)11-26-9-2-1-3-10-26/h4-6,13,18H,1-3,7-12,14H2,(H,25,28,29) |
| InChIKey | ADYCFFNMHFXBNT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|