C23H26N4O4S — CID 163822328
3-[7-[2-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]ethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 163822328) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-[7-[2-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]ethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]ethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163822328 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-[7-[2-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]ethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CCc4nc(CN5CCOCC5)cs4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O4S/c28-20-6-5-19(22(29)25-20)27-13-18-15(2-1-3-17(18)23(27)30)4-7-21-24-16(14-32-21)12-26-8-10-31-11-9-26/h1-3,14,19H,4-13H2,(H,25,28,29) |
| InChIKey | NWLRSIIJFCDNLJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|