C24H22N4O3S2 — CID 175080643
3-[7-[[4-(azepin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175080643) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[7-[[4-(azepin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-(azepin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175080643 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-[7-[[4-(azepin-1-ylmethyl)-1,3-thiazol-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4nc(CN5C=CC=CC=C5)cs4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22N4O3S2/c29-21-9-8-19(23(30)26-21)28-13-18-17(24(28)31)6-5-7-20(18)32-15-22-25-16(14-33-22)12-27-10-3-1-2-4-11-27/h1-7,10-11,14,19H,8-9,12-13,15H2,(H,26,29,30) |
| InChIKey | QELWDOCICYUSEZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|