C28H31N3O4S2 — CID 157023605
3-[7-[[2-(1-adamantyloxymethyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 157023605) has the molecular formula C28H31N3O4S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 3-[7-[[2-(1-adamantyloxymethyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[2-(1-adamantyloxymethyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 157023605 |
| Molecular Formula | C28H31N3O4S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 3-[7-[[2-(1-adamantyloxymethyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4csc(COC56CC7CC(CC(C7)C5)C6)n4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H31N3O4S2/c32-24-5-4-22(26(33)30-24)31-12-21-20(27(31)34)2-1-3-23(21)36-14-19-15-37-25(29-19)13-35-28-9-16-6-17(10-28)8-18(7-16)11-28/h1-3,15-18,22H,4-14H2,(H,30,32,33) |
| InChIKey | ZDIJVYLYKLGPOU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|