C33H39N3O3S — CID 154689500
3-[7-[[4-[[1-(1-adamantyl)ethylamino]methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689500) has the molecular formula C33H39N3O3S and a molecular weight of 557.76 g/mol. Its IUPAC name is 3-[7-[[4-[[1-(1-adamantyl)ethylamino]methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[[1-(1-adamantyl)ethylamino]methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689500 |
| Molecular Formula | C33H39N3O3S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 3-[7-[[4-[[1-(1-adamantyl)ethylamino]methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(NCc1ccc(CSc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C33H39N3O3S/c1-20(33-14-23-11-24(15-33)13-25(12-23)16-33)34-17-21-5-7-22(8-6-21)19-40-29-4-2-3-26-27(29)18-36(32(26)39)28-9-10-30(37)35-31(28)38/h2-8,20,23-25,28,34H,9-19H2,1H3,(H,35,37,38) |
| InChIKey | JMTGGRWWAORLGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|