C27H30N2O3S — CID 164988647
3-[7-[[4-(3-cyclobutylpropyl)phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164988647) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-[7-[[4-(3-cyclobutylpropyl)phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-(3-cyclobutylpropyl)phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164988647 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 3-[7-[[4-(3-cyclobutylpropyl)phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4ccc(CCCC5CCC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H30N2O3S/c30-25-15-14-23(26(31)28-25)29-16-22-21(27(29)32)8-3-9-24(22)33-17-20-12-10-19(11-13-20)7-2-6-18-4-1-5-18/h3,8-13,18,23H,1-2,4-7,14-17H2,(H,28,30,31) |
| InChIKey | GNLJUXGDPJEMNH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|