C33H41N3O3S — CID 154689429
3-[7-[[4-[(dicyclohexylamino)methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689429) has the molecular formula C33H41N3O3S and a molecular weight of 559.78 g/mol. Its IUPAC name is 3-[7-[[4-[(dicyclohexylamino)methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[(dicyclohexylamino)methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689429 |
| Molecular Formula | C33H41N3O3S |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 3-[7-[[4-[(dicyclohexylamino)methyl]phenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4ccc(CN(C5CCCCC5)C5CCCCC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H41N3O3S/c37-31-19-18-29(32(38)34-31)36-21-28-27(33(36)39)12-7-13-30(28)40-22-24-16-14-23(15-17-24)20-35(25-8-3-1-4-9-25)26-10-5-2-6-11-26/h7,12-17,25-26,29H,1-6,8-11,18-22H2,(H,34,37,38) |
| InChIKey | IWLHPTWNMXJHRM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|