C24H27N3O4S — CID 154689468
3-[7-[[5-[(cyclopentylamino)methyl]furan-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689468) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-[7-[[5-[(cyclopentylamino)methyl]furan-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[5-[(cyclopentylamino)methyl]furan-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689468 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-[7-[[5-[(cyclopentylamino)methyl]furan-2-yl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4ccc(CNC5CCCC5)o4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H27N3O4S/c28-22-11-10-20(23(29)26-22)27-13-19-18(24(27)30)6-3-7-21(19)32-14-17-9-8-16(31-17)12-25-15-4-1-2-5-15/h3,6-9,15,20,25H,1-2,4-5,10-14H2,(H,26,28,29) |
| InChIKey | LLDIYFJUMHUMTA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|