C32H36FN3O3S — CID 154689885
3-[7-[[4-[(1-adamantylmethylamino)methyl]-2-fluorophenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689885) has the molecular formula C32H36FN3O3S and a molecular weight of 561.72 g/mol. Its IUPAC name is 3-[7-[[4-[(1-adamantylmethylamino)methyl]-2-fluorophenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[(1-adamantylmethylamino)methyl]-2-fluorophenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689885 |
| Molecular Formula | C32H36FN3O3S |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 3-[7-[[4-[(1-adamantylmethylamino)methyl]-2-fluorophenyl]methylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCc4ccc(CNCC56CC7CC(CC(C7)C5)C6)cc4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H36FN3O3S/c33-26-11-19(15-34-18-32-12-20-8-21(13-32)10-22(9-20)14-32)4-5-23(26)17-40-28-3-1-2-24-25(28)16-36(31(24)39)27-6-7-29(37)35-30(27)38/h1-5,11,20-22,27,34H,6-10,12-18H2,(H,35,37,38) |
| InChIKey | SAKJWFHPAWRUIR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|