C25H31N5O3S — CID 154689927
3-[3-oxo-7-[8-(pyrimidin-4-ylamino)octylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689927) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-[3-oxo-7-[8-(pyrimidin-4-ylamino)octylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[8-(pyrimidin-4-ylamino)octylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689927 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[3-oxo-7-[8-(pyrimidin-4-ylamino)octylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCCCNc4ccncn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H31N5O3S/c31-23-11-10-20(24(32)29-23)30-16-19-18(25(30)33)8-7-9-21(19)34-15-6-4-2-1-3-5-13-27-22-12-14-26-17-28-22/h7-9,12,14,17,20H,1-6,10-11,13,15-16H2,(H,26,27,28)(H,29,31,32) |
| InChIKey | VKPZEVNDTXUBAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|