C17H15N5O3 — CID 162504336
3-[3-oxo-7-(pyrimidin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 162504336) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-[3-oxo-7-(pyrimidin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-(pyrimidin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504336 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[3-oxo-7-(pyrimidin-4-ylamino)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(Nc4ccncn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H15N5O3/c23-15-5-4-13(16(24)21-15)22-8-11-10(17(22)25)2-1-3-12(11)20-14-6-7-18-9-19-14/h1-3,6-7,9,13H,4-5,8H2,(H,18,19,20)(H,21,23,24) |
| InChIKey | PHYXPHXDZPBHQO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|