C30H23N7O3 — CID 153385159
3-[3-oxo-7-[[2-(4-phenylphenyl)-7H-purin-6-yl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 153385159) has the molecular formula C30H23N7O3 and a molecular weight of 529.56 g/mol. Its IUPAC name is 3-[3-oxo-7-[[2-(4-phenylphenyl)-7H-purin-6-yl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[2-(4-phenylphenyl)-7H-purin-6-yl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 153385159 |
| Molecular Formula | C30H23N7O3 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3-[3-oxo-7-[[2-(4-phenylphenyl)-7H-purin-6-yl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(Nc4nc(-c5ccc(-c6ccccc6)cc5)nc5nc[nH]c45)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H23N7O3/c38-24-14-13-23(29(39)34-24)37-15-21-20(30(37)40)7-4-8-22(21)33-28-25-27(32-16-31-25)35-26(36-28)19-11-9-18(10-12-19)17-5-2-1-3-6-17/h1-12,16,23H,13-15H2,(H,34,38,39)(H2,31,32,33,35,36) |
| InChIKey | IUNDFRNHHMJPTO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|