C19H19N5O6 — CID 146485144
4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 146485144) has the molecular formula C19H19N5O6 and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 146485144 |
| Molecular Formula | C19H19N5O6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nnc(Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)o1 |
| InChI | InChI=1S/C19H19N5O6/c25-14-8-7-13(17(28)21-14)24-9-11-10(18(24)29)3-1-4-12(11)20-19-23-22-15(30-19)5-2-6-16(26)27/h1,3-4,13H,2,5-9H2,(H,20,23)(H,26,27)(H,21,25,28) |
| InChIKey | VMTYSGVQNKIMPA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|