C20H21N5O5 — CID 156507322
3-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]pyrazol-1-yl]propanoic acid (PubChem CID 156507322) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 3-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 156507322 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(CNc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cn1 |
| InChI | InChI=1S/C20H21N5O5/c26-17-5-4-16(19(29)23-17)25-11-14-13(20(25)30)2-1-3-15(14)21-8-12-9-22-24(10-12)7-6-18(27)28/h1-3,9-10,16,21H,4-8,11H2,(H,27,28)(H,23,26,29) |
| InChIKey | RLYSPNGKUULFFG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|