C19H22N6O3 — CID 167729422
3-[7-[[[1-(2-aminoethyl)pyrazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167729422) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[7-[[[1-(2-aminoethyl)pyrazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[[1-(2-aminoethyl)pyrazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167729422 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-[7-[[[1-(2-aminoethyl)pyrazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCCn1cc(NCc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cn1 |
| InChI | InChI=1S/C19H22N6O3/c20-6-7-24-10-13(9-22-24)21-8-12-2-1-3-14-15(12)11-25(19(14)28)16-4-5-17(26)23-18(16)27/h1-3,9-10,16,21H,4-8,11,20H2,(H,23,26,27) |
| InChIKey | JQXXCPGJZCBZIZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|