C24H27N5O3 — CID 167722546
3-[7-[[4-(3-aminopyrrolidin-1-yl)anilino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167722546) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-[7-[[4-(3-aminopyrrolidin-1-yl)anilino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-(3-aminopyrrolidin-1-yl)anilino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167722546 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-[7-[[4-(3-aminopyrrolidin-1-yl)anilino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1CCN(c2ccc(NCc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)C1 |
| InChI | InChI=1S/C24H27N5O3/c25-16-10-11-28(13-16)18-6-4-17(5-7-18)26-12-15-2-1-3-19-20(15)14-29(24(19)32)21-8-9-22(30)27-23(21)31/h1-7,16,21,26H,8-14,25H2,(H,27,30,31) |
| InChIKey | VYYFEIYISLWDBF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|