C23H27N5O5 — CID 175095473
2-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]imidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 175095473) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]imidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]imidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 175095473 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]methyl]imidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1cnc(CNc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C23H27N5O5/c1-23(2,3)19(22(32)33)27-10-13(25-12-27)9-24-16-6-4-5-14-15(16)11-28(21(14)31)17-7-8-18(29)26-20(17)30/h4-6,10,12,17,19,24H,7-9,11H2,1-3H3,(H,32,33)(H,26,29,30) |
| InChIKey | ZGZFVUPUHIBWGD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|