C20H24N4O5 — CID 167470395
3-[7-[[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167470395) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-[7-[[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167470395 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-[7-[[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(NCC(=O)N4CCC(O)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H24N4O5/c25-12-6-8-23(9-7-12)18(27)10-21-15-3-1-2-13-14(15)11-24(20(13)29)16-4-5-17(26)22-19(16)28/h1-3,12,16,21,25H,4-11H2,(H,22,26,28) |
| InChIKey | QUZWLGCHIDAEID-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|