C23H26N6O4 — CID 167972673
3-[3-oxo-7-[[2-oxo-2-[3-(1H-pyrazol-5-yl)piperidin-1-yl]ethyl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167972673) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[3-oxo-7-[[2-oxo-2-[3-(1H-pyrazol-5-yl)piperidin-1-yl]ethyl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[2-oxo-2-[3-(1H-pyrazol-5-yl)piperidin-1-yl]ethyl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167972673 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-[3-oxo-7-[[2-oxo-2-[3-(1H-pyrazol-5-yl)piperidin-1-yl]ethyl]amino]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(NCC(=O)N4CCCC(c5ccn[nH]5)C4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N6O4/c30-20-7-6-19(22(32)26-20)29-13-16-15(23(29)33)4-1-5-18(16)24-11-21(31)28-10-2-3-14(12-28)17-8-9-25-27-17/h1,4-5,8-9,14,19,24H,2-3,6-7,10-13H2,(H,25,27)(H,26,30,32) |
| InChIKey | LBLJOLAVLXRTRA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|