C18H15N7O3 — CID 166173886
3-[6-(6-amino-7H-purin-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166173886) has the molecular formula C18H15N7O3 and a molecular weight of 377.36 g/mol. Its IUPAC name is 3-[6-(6-amino-7H-purin-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(6-amino-7H-purin-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166173886 |
| Molecular Formula | C18H15N7O3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[6-(6-amino-7H-purin-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1nc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C18H15N7O3/c19-14-13-16(21-7-20-13)24-15(23-14)8-1-2-10-9(5-8)6-25(18(10)28)11-3-4-12(26)22-17(11)27/h1-2,5,7,11H,3-4,6H2,(H,22,26,27)(H3,19,20,21,23,24) |
| InChIKey | BOPBFPJNSFOLIS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|