C27H28F2N2O2 — CID 22180536
4-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]benzoic acid (PubChem CID 22180536) has the molecular formula C27H28F2N2O2 and a molecular weight of 450.53 g/mol. Its IUPAC name is 4-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 22180536 |
| Molecular Formula | C27H28F2N2O2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 4-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28F2N2O2/c28-23-9-3-20(4-10-23)26(21-5-11-24(29)12-6-21)2-1-15-30-16-18-31(19-17-30)25-13-7-22(8-14-25)27(32)33/h3-14,26H,1-2,15-19H2,(H,32,33) |
| InChIKey | PXCBSWHCAFNTGX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |