C27H41N3O3S — CID 166921342
2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-(8-piperidin-1-yloctylsulfanyl)benzaldehyde (PubChem CID 166921342) has the molecular formula C27H41N3O3S and a molecular weight of 487.71 g/mol. Its IUPAC name is 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-(8-piperidin-1-yloctylsulfanyl)benzaldehyde.
| Compound Name | 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-(8-piperidin-1-yloctylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 166921342 |
| Molecular Formula | C27H41N3O3S |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-(8-piperidin-1-yloctylsulfanyl)benzaldehyde |
| SMILES | CN(Cc1c(C=O)cccc1SCCCCCCCCN1CCCCC1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C27H41N3O3S/c1-29(24-14-15-26(32)28-27(24)33)20-23-22(21-31)12-11-13-25(23)34-19-10-5-3-2-4-7-16-30-17-8-6-9-18-30/h11-13,21,24H,2-10,14-20H2,1H3,(H,28,32,33) |
| InChIKey | MFFBNIMTDMBKTF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|