C34H41FN6O6S — CID 167471547
1-[2-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylanilino]acetyl]-N-[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]piperidine-4-carboxamide (PubChem CID 167471547) has the molecular formula C34H41FN6O6S and a molecular weight of 680.80 g/mol. Its IUPAC name is 1-[2-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylanilino]acetyl]-N-[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylanilino]acetyl]-N-[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167471547 |
| Molecular Formula | C34H41FN6O6S |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | 1-[2-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylanilino]acetyl]-N-[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]piperidine-4-carboxamide |
| SMILES | CN(Cc1c(C=O)cccc1NCC(=O)N1CCC(C(=O)Nc2cccc(CSN3CCC(=O)CC3)c2F)CC1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C34H41FN6O6S/c1-39(29-8-9-30(44)38-34(29)47)19-26-23(20-42)4-2-6-27(26)36-18-31(45)40-14-10-22(11-15-40)33(46)37-28-7-3-5-24(32(28)35)21-48-41-16-12-25(43)13-17-41/h2-7,20,22,29,36H,8-19,21H2,1H3,(H,37,46)(H,38,44,47) |
| InChIKey | CJVSMORCXCTHPQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|