C23H32FN3O4S — CID 167470240
tert-butyl 4-[[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 167470240) has the molecular formula C23H32FN3O4S and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl 4-[[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167470240 |
| Molecular Formula | C23H32FN3O4S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | tert-butyl 4-[[2-fluoro-3-[(4-oxopiperidin-1-yl)sulfanylmethyl]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2cccc(CSN3CCC(=O)CC3)c2F)CC1 |
| InChI | InChI=1S/C23H32FN3O4S/c1-23(2,3)31-22(30)26-11-7-16(8-12-26)21(29)25-19-6-4-5-17(20(19)24)15-32-27-13-9-18(28)10-14-27/h4-6,16H,7-15H2,1-3H3,(H,25,29) |
| InChIKey | MYZSDCNLEIHAIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|