C16H22N2O4 — CID 166469610
2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-hydroxybenzaldehyde;ethane (PubChem CID 166469610) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-hydroxybenzaldehyde;ethane.
| Compound Name | 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-hydroxybenzaldehyde;ethane |
|---|---|
| PubChem CID | 166469610 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-hydroxybenzaldehyde;ethane |
| SMILES | CC.CN(Cc1cc(O)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H16N2O4.C2H6/c1-16(12-4-5-13(19)15-14(12)20)7-10-6-11(18)3-2-9(10)8-17;1-2/h2-3,6,8,12,18H,4-5,7H2,1H3,(H,15,19,20);1-2H3 |
| InChIKey | IJRUYUOQIDEECB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|