C30H40ClN5O4 — CID 166148371
1-[3-(8-aminooctyl)-5-chlorophenyl]-3-[[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]methyl]urea (PubChem CID 166148371) has the molecular formula C30H40ClN5O4 and a molecular weight of 570.13 g/mol. Its IUPAC name is 1-[3-(8-aminooctyl)-5-chlorophenyl]-3-[[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]methyl]urea.
| Compound Name | 1-[3-(8-aminooctyl)-5-chlorophenyl]-3-[[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]methyl]urea |
|---|---|
| PubChem CID | 166148371 |
| Molecular Formula | C30H40ClN5O4 |
| Molecular Weight | 570.13 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 1-[3-(8-aminooctyl)-5-chlorophenyl]-3-[[3-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-4-formylphenyl]methyl]urea |
| SMILES | CN(Cc1cc(CNC(=O)Nc2cc(Cl)cc(CCCCCCCCN)c2)ccc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H40ClN5O4/c1-36(27-11-12-28(38)35-29(27)39)19-24-14-22(9-10-23(24)20-37)18-33-30(40)34-26-16-21(15-25(31)17-26)8-6-4-2-3-5-7-13-32/h9-10,14-17,20,27H,2-8,11-13,18-19,32H2,1H3,(H2,33,34,40)(H,35,38,39) |
| InChIKey | FLHLHLYOUBKFEV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.13 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|