C29H35N3O3S — CID 166921030
3-[[4-[(dicyclopropylmethylamino)methyl]phenyl]methylsulfanyl]-2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]benzaldehyde (PubChem CID 166921030) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is 3-[[4-[(dicyclopropylmethylamino)methyl]phenyl]methylsulfanyl]-2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]benzaldehyde.
| Compound Name | 3-[[4-[(dicyclopropylmethylamino)methyl]phenyl]methylsulfanyl]-2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 166921030 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 3-[[4-[(dicyclopropylmethylamino)methyl]phenyl]methylsulfanyl]-2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]benzaldehyde |
| SMILES | CN(Cc1c(C=O)cccc1SCc1ccc(CNC(C2CC2)C2CC2)cc1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H35N3O3S/c1-32(25-13-14-27(34)31-29(25)35)16-24-23(17-33)3-2-4-26(24)36-18-20-7-5-19(6-8-20)15-30-28(21-9-10-21)22-11-12-22/h2-8,17,21-22,25,28,30H,9-16,18H2,1H3,(H,31,34,35) |
| InChIKey | SRXLYZSVYXDWEI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|