C18H26N2O3 — CID 177202054
2-[(2-formyl-6-propan-2-ylphenyl)methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 177202054) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(2-formyl-6-propan-2-ylphenyl)methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[(2-formyl-6-propan-2-ylphenyl)methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177202054 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(2-formyl-6-propan-2-ylphenyl)methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N(C)Cc1c(C=O)cccc1C(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)15-8-5-7-14(12-22)16(15)11-20(4)17(9-6-10-21)18(23)19-3/h5,7-8,10,12-13,17H,6,9,11H2,1-4H3,(H,19,23) |
| InChIKey | NNCBAXAGHAYLLG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|