C18H28N2O3 — CID 153393704
2-[(2,6-dimethylphenyl)methyl-formylamino]-N-methyl-5-oxopentanamide;ethane (PubChem CID 153393704) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)methyl-formylamino]-N-methyl-5-oxopentanamide;ethane.
| Compound Name | 2-[(2,6-dimethylphenyl)methyl-formylamino]-N-methyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 153393704 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)methyl-formylamino]-N-methyl-5-oxopentanamide;ethane |
| SMILES | CC.CNC(=O)C(CCC=O)N(C=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C16H22N2O3.C2H6/c1-12-6-4-7-13(2)14(12)10-18(11-20)15(8-5-9-19)16(21)17-3;1-2/h4,6-7,9,11,15H,5,8,10H2,1-3H3,(H,17,21);1-2H3 |
| InChIKey | HUTANNKGSPZALO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|