C19H27N3O5 — CID 171627638
3-acetamido-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide;ethane (PubChem CID 171627638) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-acetamido-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide;ethane.
| Compound Name | 3-acetamido-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide;ethane |
|---|---|
| PubChem CID | 171627638 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-acetamido-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide;ethane |
| SMILES | CC.CNC(=O)C(CCC=O)N(C=O)C(=O)c1cccc(NC(C)=O)c1C |
| InChI | InChI=1S/C17H21N3O5.C2H6/c1-11-13(6-4-7-14(11)19-12(2)23)17(25)20(10-22)15(8-5-9-21)16(24)18-3;1-2/h4,6-7,9-10,15H,5,8H2,1-3H3,(H,18,24)(H,19,23);1-2H3 |
| InChIKey | PSMQFXWWTRWKBK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|