C17H22N2O6 — CID 167039405
2-[formyl-[[2-methyl-3-(2-oxoethoxy)phenyl]methoxy]amino]-N-methyl-5-oxopentanamide (PubChem CID 167039405) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[formyl-[[2-methyl-3-(2-oxoethoxy)phenyl]methoxy]amino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[formyl-[[2-methyl-3-(2-oxoethoxy)phenyl]methoxy]amino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 167039405 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[formyl-[[2-methyl-3-(2-oxoethoxy)phenyl]methoxy]amino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N(C=O)OCc1cccc(OCC=O)c1C |
| InChI | InChI=1S/C17H22N2O6/c1-13-14(5-3-7-16(13)24-10-9-21)11-25-19(12-22)15(6-4-8-20)17(23)18-2/h3,5,7-9,12,15H,4,6,10-11H2,1-2H3,(H,18,23) |
| InChIKey | QHFUFOYXKAVJGU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|