C22H33N3O6 — CID 174321847
N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-3-[2-(2-propoxyethoxy)ethylamino]benzamide (PubChem CID 174321847) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-3-[2-(2-propoxyethoxy)ethylamino]benzamide.
| Compound Name | N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-3-[2-(2-propoxyethoxy)ethylamino]benzamide |
|---|---|
| PubChem CID | 174321847 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-3-[2-(2-propoxyethoxy)ethylamino]benzamide |
| SMILES | CCCOCCOCCNc1cccc(C(=O)N(C=O)C(CCC=O)C(=O)NC)c1C |
| InChI | InChI=1S/C22H33N3O6/c1-4-12-30-14-15-31-13-10-24-19-8-5-7-18(17(19)2)22(29)25(16-27)20(9-6-11-26)21(28)23-3/h5,7-8,11,16,20,24H,4,6,9-10,12-15H2,1-3H3,(H,23,28) |
| InChIKey | SPUKMPQUHCKIPT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|