C19H28N4O4 — CID 169257390
2-[2-(ethylamino)ethylamino]-N-(1-formamido-1-oxopentan-2-yl)-N-formyl-6-methylbenzamide (PubChem CID 169257390) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[2-(ethylamino)ethylamino]-N-(1-formamido-1-oxopentan-2-yl)-N-formyl-6-methylbenzamide.
| Compound Name | 2-[2-(ethylamino)ethylamino]-N-(1-formamido-1-oxopentan-2-yl)-N-formyl-6-methylbenzamide |
|---|---|
| PubChem CID | 169257390 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-[2-(ethylamino)ethylamino]-N-(1-formamido-1-oxopentan-2-yl)-N-formyl-6-methylbenzamide |
| SMILES | CCCC(C(=O)NC=O)N(C=O)C(=O)c1c(C)cccc1NCCNCC |
| InChI | InChI=1S/C19H28N4O4/c1-4-7-16(18(26)22-12-24)23(13-25)19(27)17-14(3)8-6-9-15(17)21-11-10-20-5-2/h6,8-9,12-13,16,20-21H,4-5,7,10-11H2,1-3H3,(H,22,24,26) |
| InChIKey | WNJCLQWUOVXXHJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|