C22H33N3O4S — CID 166921314
2-(7-aminoheptylsulfanyl)-N-(1-formamido-1-oxopentan-2-yl)-6-formyl-N-methylbenzamide (PubChem CID 166921314) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-(7-aminoheptylsulfanyl)-N-(1-formamido-1-oxopentan-2-yl)-6-formyl-N-methylbenzamide.
| Compound Name | 2-(7-aminoheptylsulfanyl)-N-(1-formamido-1-oxopentan-2-yl)-6-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 166921314 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-(7-aminoheptylsulfanyl)-N-(1-formamido-1-oxopentan-2-yl)-6-formyl-N-methylbenzamide |
| SMILES | CCCC(C(=O)NC=O)N(C)C(=O)c1c(C=O)cccc1SCCCCCCCN |
| InChI | InChI=1S/C22H33N3O4S/c1-3-10-18(21(28)24-16-27)25(2)22(29)20-17(15-26)11-9-12-19(20)30-14-8-6-4-5-7-13-23/h9,11-12,15-16,18H,3-8,10,13-14,23H2,1-2H3,(H,24,27,28) |
| InChIKey | BWWAWTCOINNNLB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|