C28H44N4O4 — CID 156819845
N-(1-formamido-1-oxopentan-2-yl)-2-formyl-N-methyl-4-[4-(5-methyloctyl)piperazin-1-yl]benzamide (PubChem CID 156819845) has the molecular formula C28H44N4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is N-(1-formamido-1-oxopentan-2-yl)-2-formyl-N-methyl-4-[4-(5-methyloctyl)piperazin-1-yl]benzamide.
| Compound Name | N-(1-formamido-1-oxopentan-2-yl)-2-formyl-N-methyl-4-[4-(5-methyloctyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 156819845 |
| Molecular Formula | C28H44N4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | N-(1-formamido-1-oxopentan-2-yl)-2-formyl-N-methyl-4-[4-(5-methyloctyl)piperazin-1-yl]benzamide |
| SMILES | CCCC(C)CCCCN1CCN(c2ccc(C(=O)N(C)C(CCC)C(=O)NC=O)c(C=O)c2)CC1 |
| InChI | InChI=1S/C28H44N4O4/c1-5-9-22(3)11-7-8-14-31-15-17-32(18-16-31)24-12-13-25(23(19-24)20-33)28(36)30(4)26(10-6-2)27(35)29-21-34/h12-13,19-22,26H,5-11,14-18H2,1-4H3,(H,29,34,35) |
| InChIKey | VHYCVUACPFFBGY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|