C20H25N3O5 — CID 167151611
2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-4-(4-oxopiperidin-1-yl)benzamide (PubChem CID 167151611) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-4-(4-oxopiperidin-1-yl)benzamide.
| Compound Name | 2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-4-(4-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 167151611 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-formyl-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-4-(4-oxopiperidin-1-yl)benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)c1ccc(N2CCC(=O)CC2)cc1C=O |
| InChI | InChI=1S/C20H25N3O5/c1-21-19(27)18(4-3-11-24)22(2)20(28)17-6-5-15(12-14(17)13-25)23-9-7-16(26)8-10-23/h5-6,11-13,18H,3-4,7-10H2,1-2H3,(H,21,27) |
| InChIKey | LRJWFUOXEXOQLH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|