C27H32F2N4O4 — CID 170727341
3-[[4-(difluoromethyl)phenyl]methyl]-N-(1-formamido-1-oxopentan-2-yl)-N-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-8-carboxamide (PubChem CID 170727341) has the molecular formula C27H32F2N4O4 and a molecular weight of 514.57 g/mol. Its IUPAC name is 3-[[4-(difluoromethyl)phenyl]methyl]-N-(1-formamido-1-oxopentan-2-yl)-N-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-8-carboxamide.
| Compound Name | 3-[[4-(difluoromethyl)phenyl]methyl]-N-(1-formamido-1-oxopentan-2-yl)-N-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 170727341 |
| Molecular Formula | C27H32F2N4O4 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 3-[[4-(difluoromethyl)phenyl]methyl]-N-(1-formamido-1-oxopentan-2-yl)-N-methyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazine-8-carboxamide |
| SMILES | CCCC(C(=O)NC=O)N(C)C(=O)c1ccc2c(c1)OCC1CN(Cc3ccc(C(F)F)cc3)CCN21 |
| InChI | InChI=1S/C27H32F2N4O4/c1-3-4-23(26(35)30-17-34)31(2)27(36)20-9-10-22-24(13-20)37-16-21-15-32(11-12-33(21)22)14-18-5-7-19(8-6-18)25(28)29/h5-10,13,17,21,23,25H,3-4,11-12,14-16H2,1-2H3,(H,30,34,35) |
| InChIKey | WKDNXLLZKPCVJI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|