C24H32N4O — CID 54671057
3-benzyl-N-(2-methylpropyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide (PubChem CID 54671057) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-benzyl-N-(2-methylpropyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide.
| Compound Name | 3-benzyl-N-(2-methylpropyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide |
|---|---|
| PubChem CID | 54671057 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-benzyl-N-(2-methylpropyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide |
| SMILES | CC(C)CNC(=O)N1Cc2ccccc2N2CCN(Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C24H32N4O/c1-19(2)14-25-24(29)27-16-21-10-6-7-11-23(21)28-13-12-26(17-22(28)18-27)15-20-8-4-3-5-9-20/h3-11,19,22H,12-18H2,1-2H3,(H,25,29) |
| InChIKey | IFOBZKZPQYVVJH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |