C23H25N5O — CID 67001619
(3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(1H-pyrazol-4-yl)methanone (PubChem CID 67001619) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(1H-pyrazol-4-yl)methanone.
| Compound Name | (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 67001619 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1Cc2ccccc2N2CCN(Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C23H25N5O/c29-23(20-12-24-25-13-20)27-15-19-8-4-5-9-22(19)28-11-10-26(16-21(28)17-27)14-18-6-2-1-3-7-18/h1-9,12-13,21H,10-11,14-17H2,(H,24,25) |
| InChIKey | LFNOMNDIVWYABN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |