C25H35N5O — CID 67001787
3-benzyl-N-[3-(dimethylamino)propyl]-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide (PubChem CID 67001787) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-benzyl-N-[3-(dimethylamino)propyl]-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide.
| Compound Name | 3-benzyl-N-[3-(dimethylamino)propyl]-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide |
|---|---|
| PubChem CID | 67001787 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-benzyl-N-[3-(dimethylamino)propyl]-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepine-6-carboxamide |
| SMILES | CN(C)CCCNC(=O)N1Cc2ccccc2N2CCN(Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C25H35N5O/c1-27(2)14-8-13-26-25(31)29-18-22-11-6-7-12-24(22)30-16-15-28(19-23(30)20-29)17-21-9-4-3-5-10-21/h3-7,9-12,23H,8,13-20H2,1-2H3,(H,26,31) |
| InChIKey | OWSGGTKYTJVCNU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|