C27H37N5O — CID 54671056
(3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 54671056) has the molecular formula C27H37N5O and a molecular weight of 447.63 g/mol. Its IUPAC name is (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 54671056 |
| Molecular Formula | C27H37N5O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | (3-benzyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)N2Cc3ccccc3N3CCN(Cc4ccccc4)CC3C2)CC1 |
| InChI | InChI=1S/C27H37N5O/c1-22(2)29-13-15-30(16-14-29)27(33)31-19-24-10-6-7-11-26(24)32-17-12-28(20-25(32)21-31)18-23-8-4-3-5-9-23/h3-11,22,25H,12-21H2,1-2H3 |
| InChIKey | QIEXWWOSPAGONM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 33.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |