C18H24N4O3 — CID 74246636
[6-hydroxy-4-(2-phenylmethoxyethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone (PubChem CID 74246636) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is [6-hydroxy-4-(2-phenylmethoxyethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone.
| Compound Name | [6-hydroxy-4-(2-phenylmethoxyethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 74246636 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [6-hydroxy-4-(2-phenylmethoxyethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(CCOCc2ccccc2)CC(O)C1 |
| InChI | InChI=1S/C18H24N4O3/c23-17-12-21(8-9-25-14-15-4-2-1-3-5-15)6-7-22(13-17)18(24)16-10-19-20-11-16/h1-5,10-11,17,23H,6-9,12-14H2,(H,19,20) |
| InChIKey | HVPMHRKCCJGCOY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|