C35H45N5O5 — CID 170729318
N-formyl-2-[14-oxo-5-[(9-phenyl-1-oxa-9-azaspiro[5.5]undecan-3-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide (PubChem CID 170729318) has the molecular formula C35H45N5O5 and a molecular weight of 615.78 g/mol. Its IUPAC name is N-formyl-2-[14-oxo-5-[(9-phenyl-1-oxa-9-azaspiro[5.5]undecan-3-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide.
| Compound Name | N-formyl-2-[14-oxo-5-[(9-phenyl-1-oxa-9-azaspiro[5.5]undecan-3-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide |
|---|---|
| PubChem CID | 170729318 |
| Molecular Formula | C35H45N5O5 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | N-formyl-2-[14-oxo-5-[(9-phenyl-1-oxa-9-azaspiro[5.5]undecan-3-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2c(ccc3c2OCC2CN(CC4CCC5(CCN(c6ccccc6)CC5)OC4)CCN32)C1=O |
| InChI | InChI=1S/C35H45N5O5/c1-2-6-31(33(42)36-24-41)40-21-29-28(34(40)43)9-10-30-32(29)44-23-27-20-37(17-18-39(27)30)19-25-11-12-35(45-22-25)13-15-38(16-14-35)26-7-4-3-5-8-26/h3-5,7-10,24-25,27,31H,2,6,11-23H2,1H3,(H,36,41,42) |
| InChIKey | CHRKMUWDVNSSRT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|