C33H42N6O4 — CID 174251659
N-formyl-4-[14-oxo-5-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide (PubChem CID 174251659) has the molecular formula C33H42N6O4 and a molecular weight of 586.74 g/mol. Its IUPAC name is N-formyl-4-[14-oxo-5-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide.
| Compound Name | N-formyl-4-[14-oxo-5-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide |
|---|---|
| PubChem CID | 174251659 |
| Molecular Formula | C33H42N6O4 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | N-formyl-4-[14-oxo-5-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-9-oxa-2,5,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),11(15),16-trien-13-yl]pentanamide |
| SMILES | CC(CCC(=O)NC=O)N1Cc2c(ccc3c2OCC2CN(CC4CCC5(CC4)CN(c4ccccn4)C5)CCN32)C1=O |
| InChI | InChI=1S/C33H42N6O4/c1-23(5-8-30(41)35-22-40)39-18-27-26(32(39)42)6-7-28-31(27)43-19-25-17-36(14-15-38(25)28)16-24-9-11-33(12-10-24)20-37(21-33)29-4-2-3-13-34-29/h2-4,6-7,13,22-25H,5,8-12,14-21H2,1H3,(H,35,40,41) |
| InChIKey | HTPJMESOMUFOIM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|