C25H31N5O2 — CID 170729126
12-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carbaldehyde (PubChem CID 170729126) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 12-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carbaldehyde.
| Compound Name | 12-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carbaldehyde |
|---|---|
| PubChem CID | 170729126 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 12-[(2-pyridin-2-yl-2-azaspiro[3.5]nonan-7-yl)methyl]-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(n1)OCC1CN(CC3CCC4(CC3)CN(c3ccccn3)C4)CCN21 |
| InChI | InChI=1S/C25H31N5O2/c31-15-20-4-5-22-24(27-20)32-16-21-14-28(11-12-30(21)22)13-19-6-8-25(9-7-19)17-29(18-25)23-3-1-2-10-26-23/h1-5,10,15,19,21H,6-9,11-14,16-18H2 |
| InChIKey | FPKNFHSANBWWKM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|