C20H30N4O4 — CID 163267553
4-(dimethylamino)-N-formylpentanamide;4-piperazin-1-ylphthalaldehyde (PubChem CID 163267553) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(dimethylamino)-N-formylpentanamide;4-piperazin-1-ylphthalaldehyde.
| Compound Name | 4-(dimethylamino)-N-formylpentanamide;4-piperazin-1-ylphthalaldehyde |
|---|---|
| PubChem CID | 163267553 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-(dimethylamino)-N-formylpentanamide;4-piperazin-1-ylphthalaldehyde |
| SMILES | CC(CCC(=O)NC=O)N(C)C.O=Cc1ccc(N2CCNCC2)cc1C=O |
| InChI | InChI=1S/C12H14N2O2.C8H16N2O2/c15-8-10-1-2-12(7-11(10)9-16)14-5-3-13-4-6-14;1-7(10(2)3)4-5-8(12)9-6-11/h1-2,7-9,13H,3-6H2;6-7H,4-5H2,1-3H3,(H,9,11,12) |
| InChIKey | VZADYWNYGADXIB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|